C35H52O6SSi — CID 90123985
(1S,5R,7S,8S)-4-methoxy-8-methyl-5-(3-methylbut-2-enyl)-8-(4-methyl-4-triethylsilyloxypentyl)-7-phenoxycarbothioyloxybicyclo[3.3.1]non-3-ene-2,9-dione (PubChem CID 90123985) has the molecular formula C35H52O6SSi and a molecular weight of 628.95 g/mol. Its IUPAC name is (1S,5R,7S,8S)-4-methoxy-8-methyl-5-(3-methylbut-2-enyl)-8-(4-methyl-4-triethylsilyloxypentyl)-7-phenoxycarbothioyloxybicyclo[3.3.1]non-3-ene-2,9-dione.
| Compound Name | (1S,5R,7S,8S)-4-methoxy-8-methyl-5-(3-methylbut-2-enyl)-8-(4-methyl-4-triethylsilyloxypentyl)-7-phenoxycarbothioyloxybicyclo[3.3.1]non-3-ene-2,9-dione |
|---|---|
| PubChem CID | 90123985 |
| Molecular Formula | C35H52O6SSi |
| Molecular Weight | 628.95 g/mol |
| Exact Mass | 628.33 |
| IUPAC Name | (1S,5R,7S,8S)-4-methoxy-8-methyl-5-(3-methylbut-2-enyl)-8-(4-methyl-4-triethylsilyloxypentyl)-7-phenoxycarbothioyloxybicyclo[3.3.1]non-3-ene-2,9-dione |
| SMILES | CC[Si](CC)(CC)OC(C)(C)CCC[C@@]1(C)[C@H]2C(=O)C=C(OC)[C@@](CC=C(C)C)(C[C@@H]1OC(=S)Oc1ccccc1)C2=O |
| InChI | InChI=1S/C35H52O6SSi/c1-10-43(11-2,12-3)41-33(6,7)20-16-21-34(8)29(40-32(42)39-26-17-14-13-15-18-26)24-35(22-19-25(4)5)28(38-9)23-27(36)30(34)31(35)37/h13-15,17-19,23,29-30H,10-12,16,20-22,24H2,1-9H3/t29-,30-,34+,35+/m0/s1 |
| InChIKey | NQSZSVTZUKJINB-BICWFCKHSA-N |
| XLogP | 8.76 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.95 |
| LogP ≤ 5 | 8.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|