C21H32O3 — CID 90124004
(2S,3S)-3-[(2,6-dimethoxy-1-prop-2-enylcyclohexa-2,5-dien-1-yl)methyl]-2-methyl-2-(4-methylpent-3-enyl)oxirane (PubChem CID 90124004) has the molecular formula C21H32O3 and a molecular weight of 332.48 g/mol. Its IUPAC name is (2S,3S)-3-[(2,6-dimethoxy-1-prop-2-enylcyclohexa-2,5-dien-1-yl)methyl]-2-methyl-2-(4-methylpent-3-enyl)oxirane.
| Compound Name | (2S,3S)-3-[(2,6-dimethoxy-1-prop-2-enylcyclohexa-2,5-dien-1-yl)methyl]-2-methyl-2-(4-methylpent-3-enyl)oxirane |
|---|---|
| PubChem CID | 90124004 |
| Molecular Formula | C21H32O3 |
| Molecular Weight | 332.48 g/mol |
| Exact Mass | 332.24 |
| IUPAC Name | (2S,3S)-3-[(2,6-dimethoxy-1-prop-2-enylcyclohexa-2,5-dien-1-yl)methyl]-2-methyl-2-(4-methylpent-3-enyl)oxirane |
| SMILES | C=CCC1(C[C@@H]2O[C@@]2(C)CCC=C(C)C)C(OC)=CCC=C1OC |
| InChI | InChI=1S/C21H32O3/c1-7-13-21(17(22-5)11-8-12-18(21)23-6)15-19-20(4,24-19)14-9-10-16(2)3/h7,10-12,19H,1,8-9,13-15H2,2-6H3/t19-,20-/m0/s1 |
| InChIKey | YTLMAYWLFXLIBE-PMACEKPBSA-N |
| XLogP | 5.31 |
| TPSA | 30.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.48 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|