C24H42O6Si — CID 90124293
1-[(4R,5S)-5-[(R)-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-hydroxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-4-tris(prop-2-enyl)silylbutan-1-ol (PubChem CID 90124293) has the molecular formula C24H42O6Si and a molecular weight of 454.68 g/mol. Its IUPAC name is 1-[(4R,5S)-5-[(R)-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-hydroxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-4-tris(prop-2-enyl)silylbutan-1-ol.
| Compound Name | 1-[(4R,5S)-5-[(R)-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-hydroxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-4-tris(prop-2-enyl)silylbutan-1-ol |
|---|---|
| PubChem CID | 90124293 |
| Molecular Formula | C24H42O6Si |
| Molecular Weight | 454.68 g/mol |
| Exact Mass | 454.28 |
| IUPAC Name | 1-[(4R,5S)-5-[(R)-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-hydroxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-4-tris(prop-2-enyl)silylbutan-1-ol |
| SMILES | C=CC[Si](CC=C)(CC=C)CCCC(O)[C@H]1OC(C)(C)O[C@H]1[C@H](O)[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C24H42O6Si/c1-8-13-31(14-9-2,15-10-3)16-11-12-18(25)21-22(30-24(6,7)29-21)20(26)19-17-27-23(4,5)28-19/h8-10,18-22,25-26H,1-3,11-17H2,4-7H3/t18?,19-,20-,21-,22+/m1/s1 |
| InChIKey | PPYORBOJUNSNJW-BHAROJNPSA-N |
| XLogP | 4.17 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.68 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|