About 1-(4-methylphenyl)ethyl N-[3-[5-(2-fluorophenyl)-1,2,4-oxadiazol-3-yl]benzoyl]carbamate
1-(4-methylphenyl)ethyl N-[3-[5-(2-fluorophenyl)-1,2,4-oxadiazol-3-yl]benzoyl]carbamate (PubChem CID 90124312) has the molecular formula C25H20FN3O4
and a molecular weight of 445.45 g/mol. Its IUPAC name is 1-(4-methylphenyl)ethyl N-[3-[5-(2-fluorophenyl)-1,2,4-oxadiazol-3-yl]benzoyl]carbamate.
Molecular Properties
| Compound Name | 1-(4-methylphenyl)ethyl N-[3-[5-(2-fluorophenyl)-1,2,4-oxadiazol-3-yl]benzoyl]carbamate |
| PubChem CID | 90124312 |
| Molecular Formula | C25H20FN3O4 |
| Molecular Weight | 445.45 g/mol |
| Exact Mass | 445.14 |
| IUPAC Name | 1-(4-methylphenyl)ethyl N-[3-[5-(2-fluorophenyl)-1,2,4-oxadiazol-3-yl]benzoyl]carbamate |
| SMILES | Cc1ccc(C(C)OC(=O)NC(=O)c2cccc(-c3noc(-c4ccccc4F)n3)c2)cc1 |
| InChI | InChI=1S/C25H20FN3O4/c1-15-10-12-17(13-11-15)16(2)32-25(31)28-23(30)19-7-5-6-18(14-19)22-27-24(33-29-22)20-8-3-4-9-21(20)26/h3-14,16H,1-2H3,(H,28,30,31) |
| InChIKey | OXORZQCYXRMBLB-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 94.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 445.45 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-(4-methylphenyl)ethyl N-[3-[5-(2-fluorophenyl)-1,2,4-oxadiazol-3-yl]benzoyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-methylphenyl)ethyl N-[3-[5-(2-fluorophenyl)-1,2,4-oxadiazol-3-yl]benzoyl]carbamate?
The IUPAC name of 1-(4-methylphenyl)ethyl N-[3-[5-(2-fluorophenyl)-1,2,4-oxadiazol-3-yl]benzoyl]carbamate (CID 90124312) is 1-(4-methylphenyl)ethyl N-[3-[5-(2-fluorophenyl)-1,2,4-oxadiazol-3-yl]benzoyl]carbamate.
What is the SMILES notation for 1-(4-methylphenyl)ethyl N-[3-[5-(2-fluorophenyl)-1,2,4-oxadiazol-3-yl]benzoyl]carbamate?
The canonical SMILES for 1-(4-methylphenyl)ethyl N-[3-[5-(2-fluorophenyl)-1,2,4-oxadiazol-3-yl]benzoyl]carbamate is Cc1ccc(C(C)OC(=O)NC(=O)c2cccc(-c3noc(-c4ccccc4F)n3)c2)cc1.
What is the InChIKey of 1-(4-methylphenyl)ethyl N-[3-[5-(2-fluorophenyl)-1,2,4-oxadiazol-3-yl]benzoyl]carbamate?
The InChIKey is OXORZQCYXRMBLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H20FN3O4/c1-15-10-12-17(13-11-15)16(2)32-25(31)28-23(30)19-7-5-6-18(14-19)22-27-24(33-29-22)20-8-3-4-9-21(20)26/h3-14,16H,1-2H3,(H,28,30,31).
What are the key properties of 1-(4-methylphenyl)ethyl N-[3-[5-(2-fluorophenyl)-1,2,4-oxadiazol-3-yl]benzoyl]carbamate?
1-(4-methylphenyl)ethyl N-[3-[5-(2-fluorophenyl)-1,2,4-oxadiazol-3-yl]benzoyl]carbamate has a molecular weight of 445.45 g/mol, XLogP of 5.48, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-methylphenyl)ethyl N-[3-[5-(2-fluorophenyl)-1,2,4-oxadiazol-3-yl]benzoyl]carbamate is sourced from PubChem (CID 90124312), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).