About tert-butyl 3,3,4-trimethyl-5-(morpholin-4-ylmethyl)-2H-indole-1-carboxylate
tert-butyl 3,3,4-trimethyl-5-(morpholin-4-ylmethyl)-2H-indole-1-carboxylate (PubChem CID 90124324) has the molecular formula C21H32N2O3
and a molecular weight of 360.50 g/mol. Its IUPAC name is tert-butyl 3,3,4-trimethyl-5-(morpholin-4-ylmethyl)-2H-indole-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 3,3,4-trimethyl-5-(morpholin-4-ylmethyl)-2H-indole-1-carboxylate |
| PubChem CID | 90124324 |
| Molecular Formula | C21H32N2O3 |
| Molecular Weight | 360.50 g/mol |
| Exact Mass | 360.24 |
| IUPAC Name | tert-butyl 3,3,4-trimethyl-5-(morpholin-4-ylmethyl)-2H-indole-1-carboxylate |
| SMILES | Cc1c(CN2CCOCC2)ccc2c1C(C)(C)CN2C(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H32N2O3/c1-15-16(13-22-9-11-25-12-10-22)7-8-17-18(15)21(5,6)14-23(17)19(24)26-20(2,3)4/h7-8H,9-14H2,1-6H3 |
| InChIKey | YZFXYFSYUGBILJ-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.50 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze tert-butyl 3,3,4-trimethyl-5-(morpholin-4-ylmethyl)-2H-indole-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 3,3,4-trimethyl-5-(morpholin-4-ylmethyl)-2H-indole-1-carboxylate?
The IUPAC name of tert-butyl 3,3,4-trimethyl-5-(morpholin-4-ylmethyl)-2H-indole-1-carboxylate (CID 90124324) is tert-butyl 3,3,4-trimethyl-5-(morpholin-4-ylmethyl)-2H-indole-1-carboxylate.
What is the SMILES notation for tert-butyl 3,3,4-trimethyl-5-(morpholin-4-ylmethyl)-2H-indole-1-carboxylate?
The canonical SMILES for tert-butyl 3,3,4-trimethyl-5-(morpholin-4-ylmethyl)-2H-indole-1-carboxylate is Cc1c(CN2CCOCC2)ccc2c1C(C)(C)CN2C(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl 3,3,4-trimethyl-5-(morpholin-4-ylmethyl)-2H-indole-1-carboxylate?
The InChIKey is YZFXYFSYUGBILJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H32N2O3/c1-15-16(13-22-9-11-25-12-10-22)7-8-17-18(15)21(5,6)14-23(17)19(24)26-20(2,3)4/h7-8H,9-14H2,1-6H3.
What are the key properties of tert-butyl 3,3,4-trimethyl-5-(morpholin-4-ylmethyl)-2H-indole-1-carboxylate?
tert-butyl 3,3,4-trimethyl-5-(morpholin-4-ylmethyl)-2H-indole-1-carboxylate has a molecular weight of 360.50 g/mol, XLogP of 3.86, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 3,3,4-trimethyl-5-(morpholin-4-ylmethyl)-2H-indole-1-carboxylate is sourced from PubChem (CID 90124324), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).