C10H16ClN3O5 — CID 90124703
4-(chloroamino)-1-[(1R)-1-[(2R,3R)-1,3-dihydroxybutan-2-yl]oxy-2-hydroxyethyl]pyrimidin-2-one (PubChem CID 90124703) has the molecular formula C10H16ClN3O5 and a molecular weight of 293.71 g/mol. Its IUPAC name is 4-(chloroamino)-1-[(1R)-1-[(2R,3R)-1,3-dihydroxybutan-2-yl]oxy-2-hydroxyethyl]pyrimidin-2-one.
| Compound Name | 4-(chloroamino)-1-[(1R)-1-[(2R,3R)-1,3-dihydroxybutan-2-yl]oxy-2-hydroxyethyl]pyrimidin-2-one |
|---|---|
| PubChem CID | 90124703 |
| Molecular Formula | C10H16ClN3O5 |
| Molecular Weight | 293.71 g/mol |
| Exact Mass | 293.08 |
| IUPAC Name | 4-(chloroamino)-1-[(1R)-1-[(2R,3R)-1,3-dihydroxybutan-2-yl]oxy-2-hydroxyethyl]pyrimidin-2-one |
| SMILES | C[C@@H](O)[C@@H](CO)O[C@H](CO)n1ccc(NCl)nc1=O |
| InChI | InChI=1S/C10H16ClN3O5/c1-6(17)7(4-15)19-9(5-16)14-3-2-8(13-11)12-10(14)18/h2-3,6-7,9,15-17H,4-5H2,1H3,(H,12,13,18)/t6-,7-,9-/m1/s1 |
| InChIKey | UNMHKCOWTSTTQC-ZXFLCMHBSA-N |
| XLogP | -0.94 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.71 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|