About 2-propoxy-4-(2,2,2-trifluoroethoxy)pyrimidine
2-propoxy-4-(2,2,2-trifluoroethoxy)pyrimidine (PubChem CID 90124983) has the molecular formula C9H11F3N2O2
and a molecular weight of 236.19 g/mol. Its IUPAC name is 2-propoxy-4-(2,2,2-trifluoroethoxy)pyrimidine.
Molecular Properties
| Compound Name | 2-propoxy-4-(2,2,2-trifluoroethoxy)pyrimidine |
| PubChem CID | 90124983 |
| Molecular Formula | C9H11F3N2O2 |
| Molecular Weight | 236.19 g/mol |
| Exact Mass | 236.08 |
| IUPAC Name | 2-propoxy-4-(2,2,2-trifluoroethoxy)pyrimidine |
| SMILES | CCCOc1nccc(OCC(F)(F)F)n1 |
| InChI | InChI=1S/C9H11F3N2O2/c1-2-5-15-8-13-4-3-7(14-8)16-6-9(10,11)12/h3-4H,2,5-6H2,1H3 |
| InChIKey | USMADMRVLQKPHN-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.19 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-propoxy-4-(2,2,2-trifluoroethoxy)pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propoxy-4-(2,2,2-trifluoroethoxy)pyrimidine?
The IUPAC name of 2-propoxy-4-(2,2,2-trifluoroethoxy)pyrimidine (CID 90124983) is 2-propoxy-4-(2,2,2-trifluoroethoxy)pyrimidine.
What is the SMILES notation for 2-propoxy-4-(2,2,2-trifluoroethoxy)pyrimidine?
The canonical SMILES for 2-propoxy-4-(2,2,2-trifluoroethoxy)pyrimidine is CCCOc1nccc(OCC(F)(F)F)n1.
What is the InChIKey of 2-propoxy-4-(2,2,2-trifluoroethoxy)pyrimidine?
The InChIKey is USMADMRVLQKPHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11F3N2O2/c1-2-5-15-8-13-4-3-7(14-8)16-6-9(10,11)12/h3-4H,2,5-6H2,1H3.
What are the key properties of 2-propoxy-4-(2,2,2-trifluoroethoxy)pyrimidine?
2-propoxy-4-(2,2,2-trifluoroethoxy)pyrimidine has a molecular weight of 236.19 g/mol, XLogP of 2.21, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propoxy-4-(2,2,2-trifluoroethoxy)pyrimidine is sourced from PubChem (CID 90124983), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).