C10H17NO2 — CID 90125027
(2E,3Z)-3-(aminomethyl)-2-ethylidene-5-methylhexa-3,5-diene-1,4-diol (PubChem CID 90125027) has the molecular formula C10H17NO2 and a molecular weight of 183.25 g/mol. Its IUPAC name is (2E,3Z)-3-(aminomethyl)-2-ethylidene-5-methylhexa-3,5-diene-1,4-diol.
| Compound Name | (2E,3Z)-3-(aminomethyl)-2-ethylidene-5-methylhexa-3,5-diene-1,4-diol |
|---|---|
| PubChem CID | 90125027 |
| Molecular Formula | C10H17NO2 |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.13 |
| IUPAC Name | (2E,3Z)-3-(aminomethyl)-2-ethylidene-5-methylhexa-3,5-diene-1,4-diol |
| SMILES | C=C(C)/C(O)=C(CN)\C(=C/C)CO |
| InChI | InChI=1S/C10H17NO2/c1-4-8(6-12)9(5-11)10(13)7(2)3/h4,12-13H,2,5-6,11H2,1,3H3/b8-4-,10-9+ |
| InChIKey | OTXKPKOWUTXKCY-CCAISUFFSA-N |
| XLogP | 1.27 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|