C16H28O3 — CID 90125029
(3Z,5E)-3-ethoxy-4,5-bis(ethoxymethyl)-2-methylhepta-1,3,5-triene (PubChem CID 90125029) has the molecular formula C16H28O3 and a molecular weight of 268.40 g/mol. Its IUPAC name is (3Z,5E)-3-ethoxy-4,5-bis(ethoxymethyl)-2-methylhepta-1,3,5-triene.
| Compound Name | (3Z,5E)-3-ethoxy-4,5-bis(ethoxymethyl)-2-methylhepta-1,3,5-triene |
|---|---|
| PubChem CID | 90125029 |
| Molecular Formula | C16H28O3 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.20 |
| IUPAC Name | (3Z,5E)-3-ethoxy-4,5-bis(ethoxymethyl)-2-methylhepta-1,3,5-triene |
| SMILES | C=C(C)/C(OCC)=C(COCC)\C(=C/C)COCC |
| InChI | InChI=1S/C16H28O3/c1-7-14(11-17-8-2)15(12-18-9-3)16(13(5)6)19-10-4/h7H,5,8-12H2,1-4,6H3/b14-7-,16-15+ |
| InChIKey | KYMXHNYVLFGEJP-ZOFTYEENSA-N |
| XLogP | 3.87 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|