C48H41NOSi — CID 90125958
9,9-dimethyl-N-(4-phenylphenyl)-N-[4-(6-trimethylsilyldibenzofuran-4-yl)phenyl]fluoren-2-amine (PubChem CID 90125958) has the molecular formula C48H41NOSi and a molecular weight of 675.95 g/mol. Its IUPAC name is 9,9-dimethyl-N-(4-phenylphenyl)-N-[4-(6-trimethylsilyldibenzofuran-4-yl)phenyl]fluoren-2-amine.
| Compound Name | 9,9-dimethyl-N-(4-phenylphenyl)-N-[4-(6-trimethylsilyldibenzofuran-4-yl)phenyl]fluoren-2-amine |
|---|---|
| PubChem CID | 90125958 |
| Molecular Formula | C48H41NOSi |
| Molecular Weight | 675.95 g/mol |
| Exact Mass | 675.30 |
| IUPAC Name | 9,9-dimethyl-N-(4-phenylphenyl)-N-[4-(6-trimethylsilyldibenzofuran-4-yl)phenyl]fluoren-2-amine |
| SMILES | CC1(C)c2ccccc2-c2ccc(N(c3ccc(-c4ccccc4)cc3)c3ccc(-c4cccc5c4oc4c([Si](C)(C)C)cccc45)cc3)cc21 |
| InChI | InChI=1S/C48H41NOSi/c1-48(2)43-19-10-9-15-39(43)40-30-29-37(31-44(40)48)49(35-25-21-33(22-26-35)32-13-7-6-8-14-32)36-27-23-34(24-28-36)38-16-11-17-41-42-18-12-20-45(51(3,4)5)47(42)50-46(38)41/h6-31H,1-5H3 |
| InChIKey | COTGPHTWFZJJJQ-UHFFFAOYSA-N |
| XLogP | 13.24 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.95 |
| LogP ≤ 5 | 13.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|