C23H29BrN2O3 — CID 90126059
4-[[[(4-bromophenyl)-dihydroxymethyl]amino]methyl]-N-cyclooctylbenzamide (PubChem CID 90126059) has the molecular formula C23H29BrN2O3 and a molecular weight of 461.40 g/mol. Its IUPAC name is 4-[[[(4-bromophenyl)-dihydroxymethyl]amino]methyl]-N-cyclooctylbenzamide.
| Compound Name | 4-[[[(4-bromophenyl)-dihydroxymethyl]amino]methyl]-N-cyclooctylbenzamide |
|---|---|
| PubChem CID | 90126059 |
| Molecular Formula | C23H29BrN2O3 |
| Molecular Weight | 461.40 g/mol |
| Exact Mass | 460.14 |
| IUPAC Name | 4-[[[(4-bromophenyl)-dihydroxymethyl]amino]methyl]-N-cyclooctylbenzamide |
| SMILES | O=C(NC1CCCCCCC1)c1ccc(CNC(O)(O)c2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C23H29BrN2O3/c24-20-14-12-19(13-15-20)23(28,29)25-16-17-8-10-18(11-9-17)22(27)26-21-6-4-2-1-3-5-7-21/h8-15,21,25,28-29H,1-7,16H2,(H,26,27) |
| InChIKey | HNJHLHDYBOGHMK-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.40 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|