C23H32F2N2 — CID 90126499
2-N-[(4Z,6E)-6-fluoro-1-(4-fluorocyclohexa-2,4-dien-1-yl)-3-methyl-2-methylidenenona-4,6,8-trienyl]cyclohexane-1,2-diamine (PubChem CID 90126499) has the molecular formula C23H32F2N2 and a molecular weight of 374.52 g/mol. Its IUPAC name is 2-N-[(4Z,6E)-6-fluoro-1-(4-fluorocyclohexa-2,4-dien-1-yl)-3-methyl-2-methylidenenona-4,6,8-trienyl]cyclohexane-1,2-diamine.
| Compound Name | 2-N-[(4Z,6E)-6-fluoro-1-(4-fluorocyclohexa-2,4-dien-1-yl)-3-methyl-2-methylidenenona-4,6,8-trienyl]cyclohexane-1,2-diamine |
|---|---|
| PubChem CID | 90126499 |
| Molecular Formula | C23H32F2N2 |
| Molecular Weight | 374.52 g/mol |
| Exact Mass | 374.25 |
| IUPAC Name | 2-N-[(4Z,6E)-6-fluoro-1-(4-fluorocyclohexa-2,4-dien-1-yl)-3-methyl-2-methylidenenona-4,6,8-trienyl]cyclohexane-1,2-diamine |
| SMILES | C=C/C=C(F)\C=C/C(C)C(=C)C(NC1CCCCC1N)C1C=CC(F)=CC1 |
| InChI | InChI=1S/C23H32F2N2/c1-4-7-19(24)13-10-16(2)17(3)23(18-11-14-20(25)15-12-18)27-22-9-6-5-8-21(22)26/h4,7,10-11,13-16,18,21-23,27H,1,3,5-6,8-9,12,26H2,2H3/b13-10-,19-7+ |
| InChIKey | FVYZHVQWGVTETO-SQJRWTEPSA-N |
| XLogP | 5.43 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.52 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|