C10H15NO — CID 90126526
(4Z,6Z)-8-methoxynona-1,4,6,8-tetraen-1-amine (PubChem CID 90126526) has the molecular formula C10H15NO and a molecular weight of 165.24 g/mol. Its IUPAC name is (4Z,6Z)-8-methoxynona-1,4,6,8-tetraen-1-amine.
| Compound Name | (4Z,6Z)-8-methoxynona-1,4,6,8-tetraen-1-amine |
|---|---|
| PubChem CID | 90126526 |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.12 |
| IUPAC Name | (4Z,6Z)-8-methoxynona-1,4,6,8-tetraen-1-amine |
| SMILES | C=C(/C=C\C=C/CC=CN)OC |
| InChI | InChI=1S/C10H15NO/c1-10(12-2)8-6-4-3-5-7-9-11/h3-4,6-9H,1,5,11H2,2H3/b4-3-,8-6-,9-7? |
| InChIKey | YKIKBXWNWULKHX-RVXMWKCSSA-N |
| XLogP | 2.12 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|