C14H16ClF2N5 — CID 90126608
7-chloro-N-[[(3R)-4,4-difluoro-1-methylpiperidin-3-yl]methyl]pyrido[3,4-b]pyrazin-5-amine (PubChem CID 90126608) has the molecular formula C14H16ClF2N5 and a molecular weight of 327.77 g/mol. Its IUPAC name is 7-chloro-N-[[(3R)-4,4-difluoro-1-methylpiperidin-3-yl]methyl]pyrido[3,4-b]pyrazin-5-amine.
| Compound Name | 7-chloro-N-[[(3R)-4,4-difluoro-1-methylpiperidin-3-yl]methyl]pyrido[3,4-b]pyrazin-5-amine |
|---|---|
| PubChem CID | 90126608 |
| Molecular Formula | C14H16ClF2N5 |
| Molecular Weight | 327.77 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | 7-chloro-N-[[(3R)-4,4-difluoro-1-methylpiperidin-3-yl]methyl]pyrido[3,4-b]pyrazin-5-amine |
| SMILES | CN1CCC(F)(F)[C@H](CNc2nc(Cl)cc3nccnc23)C1 |
| InChI | InChI=1S/C14H16ClF2N5/c1-22-5-2-14(16,17)9(8-22)7-20-13-12-10(6-11(15)21-13)18-3-4-19-12/h3-4,6,9H,2,5,7-8H2,1H3,(H,20,21)/t9-/m1/s1 |
| InChIKey | UGOIPUBQIJVZGX-SECBINFHSA-N |
| XLogP | 2.68 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.77 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|