C18H34N2 — CID 90126664
N'-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]propane-1,3-diamine (PubChem CID 90126664) has the molecular formula C18H34N2 and a molecular weight of 278.48 g/mol. Its IUPAC name is N'-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]propane-1,3-diamine.
| Compound Name | N'-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 90126664 |
| Molecular Formula | C18H34N2 |
| Molecular Weight | 278.48 g/mol |
| Exact Mass | 278.27 |
| IUPAC Name | N'-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]propane-1,3-diamine |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CNCCCN |
| InChI | InChI=1S/C18H34N2/c1-16(2)8-5-9-17(3)10-6-11-18(4)12-15-20-14-7-13-19/h8,10,12,20H,5-7,9,11,13-15,19H2,1-4H3/b17-10+,18-12+ |
| InChIKey | KESBBHIYXUANDD-VZRGJMDUSA-N |
| XLogP | 4.34 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.48 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|