C19H36N2 — CID 90126666
N'-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]butane-1,4-diamine (PubChem CID 90126666) has the molecular formula C19H36N2 and a molecular weight of 292.51 g/mol. Its IUPAC name is N'-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]butane-1,4-diamine.
| Compound Name | N'-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]butane-1,4-diamine |
|---|---|
| PubChem CID | 90126666 |
| Molecular Formula | C19H36N2 |
| Molecular Weight | 292.51 g/mol |
| Exact Mass | 292.29 |
| IUPAC Name | N'-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]butane-1,4-diamine |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CNCCCCN |
| InChI | InChI=1S/C19H36N2/c1-17(2)9-7-10-18(3)11-8-12-19(4)13-16-21-15-6-5-14-20/h9,11,13,21H,5-8,10,12,14-16,20H2,1-4H3/b18-11+,19-13+ |
| InChIKey | XSVVQHKMJPUNSL-NWLVNBMCSA-N |
| XLogP | 4.73 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.51 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|