About 3-(4,6-diaminohex-2-en-3-ylamino)-4-methylpentan-2-one
3-(4,6-diaminohex-2-en-3-ylamino)-4-methylpentan-2-one (PubChem CID 90126804) has the molecular formula C12H25N3O
and a molecular weight of 227.35 g/mol. Its IUPAC name is 3-(4,6-diaminohex-2-en-3-ylamino)-4-methylpentan-2-one.
Molecular Properties
| Compound Name | 3-(4,6-diaminohex-2-en-3-ylamino)-4-methylpentan-2-one |
| PubChem CID | 90126804 |
| Molecular Formula | C12H25N3O |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.20 |
| IUPAC Name | 3-(4,6-diaminohex-2-en-3-ylamino)-4-methylpentan-2-one |
| SMILES | CC=C(NC(C(C)=O)C(C)C)C(N)CCN |
| InChI | InChI=1S/C12H25N3O/c1-5-11(10(14)6-7-13)15-12(8(2)3)9(4)16/h5,8,10,12,15H,6-7,13-14H2,1-4H3 |
| InChIKey | SRMHOFUZCGYRRS-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(4,6-diaminohex-2-en-3-ylamino)-4-methylpentan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4,6-diaminohex-2-en-3-ylamino)-4-methylpentan-2-one?
The IUPAC name of 3-(4,6-diaminohex-2-en-3-ylamino)-4-methylpentan-2-one (CID 90126804) is 3-(4,6-diaminohex-2-en-3-ylamino)-4-methylpentan-2-one.
What is the SMILES notation for 3-(4,6-diaminohex-2-en-3-ylamino)-4-methylpentan-2-one?
The canonical SMILES for 3-(4,6-diaminohex-2-en-3-ylamino)-4-methylpentan-2-one is CC=C(NC(C(C)=O)C(C)C)C(N)CCN.
What is the InChIKey of 3-(4,6-diaminohex-2-en-3-ylamino)-4-methylpentan-2-one?
The InChIKey is SRMHOFUZCGYRRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25N3O/c1-5-11(10(14)6-7-13)15-12(8(2)3)9(4)16/h5,8,10,12,15H,6-7,13-14H2,1-4H3.
What are the key properties of 3-(4,6-diaminohex-2-en-3-ylamino)-4-methylpentan-2-one?
3-(4,6-diaminohex-2-en-3-ylamino)-4-methylpentan-2-one has a molecular weight of 227.35 g/mol, XLogP of 0.77, 7 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4,6-diaminohex-2-en-3-ylamino)-4-methylpentan-2-one is sourced from PubChem (CID 90126804), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).