C7H8F3NO — CID 90127126
2,2,2-trifluoro-N-[(3E)-penta-1,3-dien-3-yl]acetamide (PubChem CID 90127126) has the molecular formula C7H8F3NO and a molecular weight of 179.14 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[(3E)-penta-1,3-dien-3-yl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[(3E)-penta-1,3-dien-3-yl]acetamide |
|---|---|
| PubChem CID | 90127126 |
| Molecular Formula | C7H8F3NO |
| Molecular Weight | 179.14 g/mol |
| Exact Mass | 179.06 |
| IUPAC Name | 2,2,2-trifluoro-N-[(3E)-penta-1,3-dien-3-yl]acetamide |
| SMILES | C=C/C(=C\C)NC(=O)C(F)(F)F |
| InChI | InChI=1S/C7H8F3NO/c1-3-5(4-2)11-6(12)7(8,9)10/h3-4H,1H2,2H3,(H,11,12)/b5-4+ |
| InChIKey | RVFKOMIYBFPFKH-SNAWJCMRSA-N |
| XLogP | 1.75 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.14 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|