About 7-chloro-1,2-dimethylbenzimidazole-5,6-diol
7-chloro-1,2-dimethylbenzimidazole-5,6-diol (PubChem CID 90127246) has the molecular formula C9H9ClN2O2
and a molecular weight of 212.64 g/mol. Its IUPAC name is 7-chloro-1,2-dimethylbenzimidazole-5,6-diol.
Molecular Properties
| Compound Name | 7-chloro-1,2-dimethylbenzimidazole-5,6-diol |
| PubChem CID | 90127246 |
| Molecular Formula | C9H9ClN2O2 |
| Molecular Weight | 212.64 g/mol |
| Exact Mass | 212.04 |
| IUPAC Name | 7-chloro-1,2-dimethylbenzimidazole-5,6-diol |
| SMILES | Cc1nc2cc(O)c(O)c(Cl)c2n1C |
| InChI | InChI=1S/C9H9ClN2O2/c1-4-11-5-3-6(13)9(14)7(10)8(5)12(4)2/h3,13-14H,1-2H3 |
| InChIKey | DGGWXFOFPTZHJD-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.64 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 7-chloro-1,2-dimethylbenzimidazole-5,6-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chloro-1,2-dimethylbenzimidazole-5,6-diol?
The IUPAC name of 7-chloro-1,2-dimethylbenzimidazole-5,6-diol (CID 90127246) is 7-chloro-1,2-dimethylbenzimidazole-5,6-diol.
What is the SMILES notation for 7-chloro-1,2-dimethylbenzimidazole-5,6-diol?
The canonical SMILES for 7-chloro-1,2-dimethylbenzimidazole-5,6-diol is Cc1nc2cc(O)c(O)c(Cl)c2n1C.
What is the InChIKey of 7-chloro-1,2-dimethylbenzimidazole-5,6-diol?
The InChIKey is DGGWXFOFPTZHJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9ClN2O2/c1-4-11-5-3-6(13)9(14)7(10)8(5)12(4)2/h3,13-14H,1-2H3.
What are the key properties of 7-chloro-1,2-dimethylbenzimidazole-5,6-diol?
7-chloro-1,2-dimethylbenzimidazole-5,6-diol has a molecular weight of 212.64 g/mol, XLogP of 1.95, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chloro-1,2-dimethylbenzimidazole-5,6-diol is sourced from PubChem (CID 90127246), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).