C18H25F2N3O — CID 90127698
(2R,3S,5R)-2-(2,5-difluorophenyl)-5-(1-methyl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl)oxan-3-amine (PubChem CID 90127698) has the molecular formula C18H25F2N3O and a molecular weight of 337.41 g/mol. Its IUPAC name is (2R,3S,5R)-2-(2,5-difluorophenyl)-5-(1-methyl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl)oxan-3-amine.
| Compound Name | (2R,3S,5R)-2-(2,5-difluorophenyl)-5-(1-methyl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl)oxan-3-amine |
|---|---|
| PubChem CID | 90127698 |
| Molecular Formula | C18H25F2N3O |
| Molecular Weight | 337.41 g/mol |
| Exact Mass | 337.20 |
| IUPAC Name | (2R,3S,5R)-2-(2,5-difluorophenyl)-5-(1-methyl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl)oxan-3-amine |
| SMILES | CN1CCC2C1CCN2[C@H]1CO[C@H](c2cc(F)ccc2F)[C@@H](N)C1 |
| InChI | InChI=1S/C18H25F2N3O/c1-22-6-4-17-16(22)5-7-23(17)12-9-15(21)18(24-10-12)13-8-11(19)2-3-14(13)20/h2-3,8,12,15-18H,4-7,9-10,21H2,1H3/t12-,15+,16?,17?,18-/m1/s1 |
| InChIKey | HYGLKDLWOGJWLI-PZIQEYCKSA-N |
| XLogP | 1.90 |
| TPSA | 41.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.41 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |