C17H23F2N5O3S — CID 90127822
6-[(3R,5S,6R)-5-(aminodiazenyl)-6-(2,5-difluorophenyl)oxan-3-yl]-3-methylsulfonyl-3,6-diazabicyclo[3.2.0]heptane (PubChem CID 90127822) has the molecular formula C17H23F2N5O3S and a molecular weight of 415.47 g/mol. Its IUPAC name is 6-[(3R,5S,6R)-5-(aminodiazenyl)-6-(2,5-difluorophenyl)oxan-3-yl]-3-methylsulfonyl-3,6-diazabicyclo[3.2.0]heptane.
| Compound Name | 6-[(3R,5S,6R)-5-(aminodiazenyl)-6-(2,5-difluorophenyl)oxan-3-yl]-3-methylsulfonyl-3,6-diazabicyclo[3.2.0]heptane |
|---|---|
| PubChem CID | 90127822 |
| Molecular Formula | C17H23F2N5O3S |
| Molecular Weight | 415.47 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | 6-[(3R,5S,6R)-5-(aminodiazenyl)-6-(2,5-difluorophenyl)oxan-3-yl]-3-methylsulfonyl-3,6-diazabicyclo[3.2.0]heptane |
| SMILES | CS(=O)(=O)N1CC2CN([C@H]3CO[C@H](c4cc(F)ccc4F)[C@@H](/N=N/N)C3)C2C1 |
| InChI | InChI=1S/C17H23F2N5O3S/c1-28(25,26)23-6-10-7-24(16(10)8-23)12-5-15(21-22-20)17(27-9-12)13-4-11(18)2-3-14(13)19/h2-4,10,12,15-17H,5-9H2,1H3,(H2,20,21)/t10?,12-,15+,16?,17-/m1/s1 |
| InChIKey | BNSIMMBLPMAOSU-QGWQPQKZSA-N |
| XLogP | 1.06 |
| TPSA | 100.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.47 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|