C7H11NS — CID 90127868
5-methyl-1,3,4,6-tetrahydrothieno[3,4-c]pyrrole (PubChem CID 90127868) has the molecular formula C7H11NS and a molecular weight of 141.24 g/mol. Its IUPAC name is 5-methyl-1,3,4,6-tetrahydrothieno[3,4-c]pyrrole.
| Compound Name | 5-methyl-1,3,4,6-tetrahydrothieno[3,4-c]pyrrole |
|---|---|
| PubChem CID | 90127868 |
| Molecular Formula | C7H11NS |
| Molecular Weight | 141.24 g/mol |
| Exact Mass | 141.06 |
| IUPAC Name | 5-methyl-1,3,4,6-tetrahydrothieno[3,4-c]pyrrole |
| SMILES | CN1CC2=C(CSC2)C1 |
| InChI | InChI=1S/C7H11NS/c1-8-2-6-4-9-5-7(6)3-8/h2-5H2,1H3 |
| InChIKey | CEZZINDCKFHBTD-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.24 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|