About (2-oxooxolan-3-yl) 2-(1-hydroxy-2,2-dimethylbutoxy)acetate
(2-oxooxolan-3-yl) 2-(1-hydroxy-2,2-dimethylbutoxy)acetate (PubChem CID 90128309) has the molecular formula C12H20O6
and a molecular weight of 260.29 g/mol. Its IUPAC name is (2-oxooxolan-3-yl) 2-(1-hydroxy-2,2-dimethylbutoxy)acetate.
Molecular Properties
| Compound Name | (2-oxooxolan-3-yl) 2-(1-hydroxy-2,2-dimethylbutoxy)acetate |
| PubChem CID | 90128309 |
| Molecular Formula | C12H20O6 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | (2-oxooxolan-3-yl) 2-(1-hydroxy-2,2-dimethylbutoxy)acetate |
| SMILES | CCC(C)(C)C(O)OCC(=O)OC1CCOC1=O |
| InChI | InChI=1S/C12H20O6/c1-4-12(2,3)11(15)17-7-9(13)18-8-5-6-16-10(8)14/h8,11,15H,4-7H2,1-3H3 |
| InChIKey | MZPCGZWBGRBTKY-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze (2-oxooxolan-3-yl) 2-(1-hydroxy-2,2-dimethylbutoxy)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-oxooxolan-3-yl) 2-(1-hydroxy-2,2-dimethylbutoxy)acetate?
The IUPAC name of (2-oxooxolan-3-yl) 2-(1-hydroxy-2,2-dimethylbutoxy)acetate (CID 90128309) is (2-oxooxolan-3-yl) 2-(1-hydroxy-2,2-dimethylbutoxy)acetate.
What is the SMILES notation for (2-oxooxolan-3-yl) 2-(1-hydroxy-2,2-dimethylbutoxy)acetate?
The canonical SMILES for (2-oxooxolan-3-yl) 2-(1-hydroxy-2,2-dimethylbutoxy)acetate is CCC(C)(C)C(O)OCC(=O)OC1CCOC1=O.
What is the InChIKey of (2-oxooxolan-3-yl) 2-(1-hydroxy-2,2-dimethylbutoxy)acetate?
The InChIKey is MZPCGZWBGRBTKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20O6/c1-4-12(2,3)11(15)17-7-9(13)18-8-5-6-16-10(8)14/h8,11,15H,4-7H2,1-3H3.
What are the key properties of (2-oxooxolan-3-yl) 2-(1-hydroxy-2,2-dimethylbutoxy)acetate?
(2-oxooxolan-3-yl) 2-(1-hydroxy-2,2-dimethylbutoxy)acetate has a molecular weight of 260.29 g/mol, XLogP of 0.62, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2-oxooxolan-3-yl) 2-(1-hydroxy-2,2-dimethylbutoxy)acetate is sourced from PubChem (CID 90128309), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).