C20H16F4O2 — CID 90128842
3,4,5,6-tetrafluoro-2-(2-methoxyethyl)-7-[(E)-prop-1-enoxy]phenanthrene (PubChem CID 90128842) has the molecular formula C20H16F4O2 and a molecular weight of 364.34 g/mol. Its IUPAC name is 3,4,5,6-tetrafluoro-2-(2-methoxyethyl)-7-[(E)-prop-1-enoxy]phenanthrene.
| Compound Name | 3,4,5,6-tetrafluoro-2-(2-methoxyethyl)-7-[(E)-prop-1-enoxy]phenanthrene |
|---|---|
| PubChem CID | 90128842 |
| Molecular Formula | C20H16F4O2 |
| Molecular Weight | 364.34 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | 3,4,5,6-tetrafluoro-2-(2-methoxyethyl)-7-[(E)-prop-1-enoxy]phenanthrene |
| SMILES | C/C=C/Oc1cc2ccc3cc(CCOC)c(F)c(F)c3c2c(F)c1F |
| InChI | InChI=1S/C20H16F4O2/c1-3-7-26-14-10-12-5-4-11-9-13(6-8-25-2)17(21)19(23)15(11)16(12)20(24)18(14)22/h3-5,7,9-10H,6,8H2,1-2H3/b7-3+ |
| InChIKey | FLRFTBGWKZUWHM-XVNBXDOJSA-N |
| XLogP | 5.65 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.34 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|