C11H8Cl2N2S — CID 901291
2-(3,5-dichlorophenyl)sulfanylpyridin-3-amine (PubChem CID 901291) has the molecular formula C11H8Cl2N2S and a molecular weight of 271.17 g/mol. Its IUPAC name is 2-(3,5-dichlorophenyl)sulfanylpyridin-3-amine.
| Compound Name | 2-(3,5-dichlorophenyl)sulfanylpyridin-3-amine |
|---|---|
| PubChem CID | 901291 |
| Molecular Formula | C11H8Cl2N2S |
| Molecular Weight | 271.17 g/mol |
| Exact Mass | 269.98 |
| IUPAC Name | 2-(3,5-dichlorophenyl)sulfanylpyridin-3-amine |
| SMILES | Nc1cccnc1Sc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C11H8Cl2N2S/c12-7-4-8(13)6-9(5-7)16-11-10(14)2-1-3-15-11/h1-6H,14H2 |
| InChIKey | GEIFGEWMNSQMIH-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.17 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |