C38H23N3S — CID 90129250
3-dibenzothiophen-3-yl-9-[4-(2,3,4,5,6-pentadeuteriophenyl)quinazolin-2-yl]carbazole (PubChem CID 90129250) has the molecular formula C38H23N3S and a molecular weight of 558.72 g/mol. Its IUPAC name is 3-dibenzothiophen-3-yl-9-[4-(2,3,4,5,6-pentadeuteriophenyl)quinazolin-2-yl]carbazole.
| Compound Name | 3-dibenzothiophen-3-yl-9-[4-(2,3,4,5,6-pentadeuteriophenyl)quinazolin-2-yl]carbazole |
|---|---|
| PubChem CID | 90129250 |
| Molecular Formula | C38H23N3S |
| Molecular Weight | 558.72 g/mol |
| Exact Mass | 558.19 |
| IUPAC Name | 3-dibenzothiophen-3-yl-9-[4-(2,3,4,5,6-pentadeuteriophenyl)quinazolin-2-yl]carbazole |
| SMILES | [2H]c1c([2H])c([2H])c(-c2nc(-n3c4ccccc4c4cc(-c5ccc6c(c5)sc5ccccc56)ccc43)nc3ccccc23)c([2H])c1[2H] |
| InChI | InChI=1S/C38H23N3S/c1-2-10-24(11-3-1)37-30-14-4-7-15-32(30)39-38(40-37)41-33-16-8-5-12-27(33)31-22-25(19-21-34(31)41)26-18-20-29-28-13-6-9-17-35(28)42-36(29)23-26/h1-23H/i1D,2D,3D,10D,11D |
| InChIKey | VATMHIAFTAFHCQ-PDNVFQDQSA-N |
| XLogP | 10.43 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.72 |
| LogP ≤ 5 | 10.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |