C24H19ClN4O3S — CID 90129776
2-chloro-4-(1,1-dioxo-1,2-thiazolidin-2-yl)-N-(3-quinazolin-2-ylphenyl)benzamide (PubChem CID 90129776) has the molecular formula C24H19ClN4O3S and a molecular weight of 478.96 g/mol. Its IUPAC name is 2-chloro-4-(1,1-dioxo-1,2-thiazolidin-2-yl)-N-(3-quinazolin-2-ylphenyl)benzamide.
| Compound Name | 2-chloro-4-(1,1-dioxo-1,2-thiazolidin-2-yl)-N-(3-quinazolin-2-ylphenyl)benzamide |
|---|---|
| PubChem CID | 90129776 |
| Molecular Formula | C24H19ClN4O3S |
| Molecular Weight | 478.96 g/mol |
| Exact Mass | 478.09 |
| IUPAC Name | 2-chloro-4-(1,1-dioxo-1,2-thiazolidin-2-yl)-N-(3-quinazolin-2-ylphenyl)benzamide |
| SMILES | O=C(Nc1cccc(-c2ncc3ccccc3n2)c1)c1ccc(N2CCCS2(=O)=O)cc1Cl |
| InChI | InChI=1S/C24H19ClN4O3S/c25-21-14-19(29-11-4-12-33(29,31)32)9-10-20(21)24(30)27-18-7-3-6-16(13-18)23-26-15-17-5-1-2-8-22(17)28-23/h1-3,5-10,13-15H,4,11-12H2,(H,27,30) |
| InChIKey | HSMVGEFAWRDHGZ-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.96 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |