About (4-ethoxyphenyl)urea
(4-ethoxyphenyl)urea (PubChem CID 9013) has the molecular formula C9H12N2O2
and a molecular weight of 180.21 g/mol. Its IUPAC name is (4-ethoxyphenyl)urea.
Molecular Properties
| Compound Name | (4-ethoxyphenyl)urea |
| PubChem CID | 9013 |
| Molecular Formula | C9H12N2O2 |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.09 |
| IUPAC Name | (4-ethoxyphenyl)urea |
| SMILES | CCOc1ccc(NC(N)=O)cc1 |
| InChI | InChI=1S/C9H12N2O2/c1-2-13-8-5-3-7(4-6-8)11-9(10)12/h3-6H,2H2,1H3,(H3,10,11,12) |
| InChIKey | GGLIEWRLXDLBBF-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4-ethoxyphenyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-ethoxyphenyl)urea?
The IUPAC name of (4-ethoxyphenyl)urea (CID 9013) is (4-ethoxyphenyl)urea.
What is the SMILES notation for (4-ethoxyphenyl)urea?
The canonical SMILES for (4-ethoxyphenyl)urea is CCOc1ccc(NC(N)=O)cc1.
What is the InChIKey of (4-ethoxyphenyl)urea?
The InChIKey is GGLIEWRLXDLBBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O2/c1-2-13-8-5-3-7(4-6-8)11-9(10)12/h3-6H,2H2,1H3,(H3,10,11,12).
What are the key properties of (4-ethoxyphenyl)urea?
(4-ethoxyphenyl)urea has a molecular weight of 180.21 g/mol, XLogP of 1.58, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-ethoxyphenyl)urea is sourced from PubChem (CID 9013), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).