C25H21FN4O3S — CID 90130019
4-(1,1-dioxothiazinan-2-yl)-2-fluoro-N-[3-(1,6-naphthyridin-5-yl)phenyl]benzamide (PubChem CID 90130019) has the molecular formula C25H21FN4O3S and a molecular weight of 476.53 g/mol. Its IUPAC name is 4-(1,1-dioxothiazinan-2-yl)-2-fluoro-N-[3-(1,6-naphthyridin-5-yl)phenyl]benzamide.
| Compound Name | 4-(1,1-dioxothiazinan-2-yl)-2-fluoro-N-[3-(1,6-naphthyridin-5-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 90130019 |
| Molecular Formula | C25H21FN4O3S |
| Molecular Weight | 476.53 g/mol |
| Exact Mass | 476.13 |
| IUPAC Name | 4-(1,1-dioxothiazinan-2-yl)-2-fluoro-N-[3-(1,6-naphthyridin-5-yl)phenyl]benzamide |
| SMILES | O=C(Nc1cccc(-c2nccc3ncccc23)c1)c1ccc(N2CCCCS2(=O)=O)cc1F |
| InChI | InChI=1S/C25H21FN4O3S/c26-22-16-19(30-13-1-2-14-34(30,32)33)8-9-20(22)25(31)29-18-6-3-5-17(15-18)24-21-7-4-11-27-23(21)10-12-28-24/h3-12,15-16H,1-2,13-14H2,(H,29,31) |
| InChIKey | BHUVXLCVEAKPJH-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.53 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |