C26H23ClN4O3S — CID 90130048
N-[4-chloro-3-(2,7-naphthyridin-1-yl)phenyl]-4-(1,1-dioxothiazepan-2-yl)benzamide (PubChem CID 90130048) has the molecular formula C26H23ClN4O3S and a molecular weight of 507.02 g/mol. Its IUPAC name is N-[4-chloro-3-(2,7-naphthyridin-1-yl)phenyl]-4-(1,1-dioxothiazepan-2-yl)benzamide.
| Compound Name | N-[4-chloro-3-(2,7-naphthyridin-1-yl)phenyl]-4-(1,1-dioxothiazepan-2-yl)benzamide |
|---|---|
| PubChem CID | 90130048 |
| Molecular Formula | C26H23ClN4O3S |
| Molecular Weight | 507.02 g/mol |
| Exact Mass | 506.12 |
| IUPAC Name | N-[4-chloro-3-(2,7-naphthyridin-1-yl)phenyl]-4-(1,1-dioxothiazepan-2-yl)benzamide |
| SMILES | O=C(Nc1ccc(Cl)c(-c2nccc3ccncc23)c1)c1ccc(N2CCCCCS2(=O)=O)cc1 |
| InChI | InChI=1S/C26H23ClN4O3S/c27-24-9-6-20(16-22(24)25-23-17-28-12-10-18(23)11-13-29-25)30-26(32)19-4-7-21(8-5-19)31-14-2-1-3-15-35(31,33)34/h4-13,16-17H,1-3,14-15H2,(H,30,32) |
| InChIKey | CLTAHQHBPOMXFQ-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.02 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |