About 4-(1,1-dioxothiazepan-2-yl)-N-(3-isoquinolin-1-yl-4-methylphenyl)benzenesulfonamide
4-(1,1-dioxothiazepan-2-yl)-N-(3-isoquinolin-1-yl-4-methylphenyl)benzenesulfonamide (PubChem CID 90130060) has the molecular formula C27H27N3O4S2
and a molecular weight of 521.66 g/mol. Its IUPAC name is 4-(1,1-dioxothiazepan-2-yl)-N-(3-isoquinolin-1-yl-4-methylphenyl)benzenesulfonamide.
Molecular Properties
| Compound Name | 4-(1,1-dioxothiazepan-2-yl)-N-(3-isoquinolin-1-yl-4-methylphenyl)benzenesulfonamide |
| PubChem CID | 90130060 |
| Molecular Formula | C27H27N3O4S2 |
| Molecular Weight | 521.66 g/mol |
| Exact Mass | 521.14 |
| IUPAC Name | 4-(1,1-dioxothiazepan-2-yl)-N-(3-isoquinolin-1-yl-4-methylphenyl)benzenesulfonamide |
| SMILES | Cc1ccc(NS(=O)(=O)c2ccc(N3CCCCCS3(=O)=O)cc2)cc1-c1nccc2ccccc12 |
| InChI | InChI=1S/C27H27N3O4S2/c1-20-9-10-22(19-26(20)27-25-8-4-3-7-21(25)15-16-28-27)29-36(33,34)24-13-11-23(12-14-24)30-17-5-2-6-18-35(30,31)32/h3-4,7-16,19,29H,2,5-6,17-18H2,1H3 |
| InChIKey | MZZUFGFQIMTNLB-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 96.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 521.66 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(1,1-dioxothiazepan-2-yl)-N-(3-isoquinolin-1-yl-4-methylphenyl)benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1,1-dioxothiazepan-2-yl)-N-(3-isoquinolin-1-yl-4-methylphenyl)benzenesulfonamide?
The IUPAC name of 4-(1,1-dioxothiazepan-2-yl)-N-(3-isoquinolin-1-yl-4-methylphenyl)benzenesulfonamide (CID 90130060) is 4-(1,1-dioxothiazepan-2-yl)-N-(3-isoquinolin-1-yl-4-methylphenyl)benzenesulfonamide.
What is the SMILES notation for 4-(1,1-dioxothiazepan-2-yl)-N-(3-isoquinolin-1-yl-4-methylphenyl)benzenesulfonamide?
The canonical SMILES for 4-(1,1-dioxothiazepan-2-yl)-N-(3-isoquinolin-1-yl-4-methylphenyl)benzenesulfonamide is Cc1ccc(NS(=O)(=O)c2ccc(N3CCCCCS3(=O)=O)cc2)cc1-c1nccc2ccccc12.
What is the InChIKey of 4-(1,1-dioxothiazepan-2-yl)-N-(3-isoquinolin-1-yl-4-methylphenyl)benzenesulfonamide?
The InChIKey is MZZUFGFQIMTNLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H27N3O4S2/c1-20-9-10-22(19-26(20)27-25-8-4-3-7-21(25)15-16-28-27)29-36(33,34)24-13-11-23(12-14-24)30-17-5-2-6-18-35(30,31)32/h3-4,7-16,19,29H,2,5-6,17-18H2,1H3.
What are the key properties of 4-(1,1-dioxothiazepan-2-yl)-N-(3-isoquinolin-1-yl-4-methylphenyl)benzenesulfonamide?
4-(1,1-dioxothiazepan-2-yl)-N-(3-isoquinolin-1-yl-4-methylphenyl)benzenesulfonamide has a molecular weight of 521.66 g/mol, XLogP of 5.33, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,1-dioxothiazepan-2-yl)-N-(3-isoquinolin-1-yl-4-methylphenyl)benzenesulfonamide is sourced from PubChem (CID 90130060), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).