About 4-(1,1-dioxothiazinan-2-yl)-2-fluoro-N-(3-isoquinolin-1-yl-4-methylphenyl)benzamide
4-(1,1-dioxothiazinan-2-yl)-2-fluoro-N-(3-isoquinolin-1-yl-4-methylphenyl)benzamide (PubChem CID 90130105) has the molecular formula C27H24FN3O3S
and a molecular weight of 489.57 g/mol. Its IUPAC name is 4-(1,1-dioxothiazinan-2-yl)-2-fluoro-N-(3-isoquinolin-1-yl-4-methylphenyl)benzamide.
Molecular Properties
| Compound Name | 4-(1,1-dioxothiazinan-2-yl)-2-fluoro-N-(3-isoquinolin-1-yl-4-methylphenyl)benzamide |
| PubChem CID | 90130105 |
| Molecular Formula | C27H24FN3O3S |
| Molecular Weight | 489.57 g/mol |
| Exact Mass | 489.15 |
| IUPAC Name | 4-(1,1-dioxothiazinan-2-yl)-2-fluoro-N-(3-isoquinolin-1-yl-4-methylphenyl)benzamide |
| SMILES | Cc1ccc(NC(=O)c2ccc(N3CCCCS3(=O)=O)cc2F)cc1-c1nccc2ccccc12 |
| InChI | InChI=1S/C27H24FN3O3S/c1-18-8-9-20(16-24(18)26-22-7-3-2-6-19(22)12-13-29-26)30-27(32)23-11-10-21(17-25(23)28)31-14-4-5-15-35(31,33)34/h2-3,6-13,16-17H,4-5,14-15H2,1H3,(H,30,32) |
| InChIKey | HGIWLYPNLKGOGQ-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 489.57 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(1,1-dioxothiazinan-2-yl)-2-fluoro-N-(3-isoquinolin-1-yl-4-methylphenyl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1,1-dioxothiazinan-2-yl)-2-fluoro-N-(3-isoquinolin-1-yl-4-methylphenyl)benzamide?
The IUPAC name of 4-(1,1-dioxothiazinan-2-yl)-2-fluoro-N-(3-isoquinolin-1-yl-4-methylphenyl)benzamide (CID 90130105) is 4-(1,1-dioxothiazinan-2-yl)-2-fluoro-N-(3-isoquinolin-1-yl-4-methylphenyl)benzamide.
What is the SMILES notation for 4-(1,1-dioxothiazinan-2-yl)-2-fluoro-N-(3-isoquinolin-1-yl-4-methylphenyl)benzamide?
The canonical SMILES for 4-(1,1-dioxothiazinan-2-yl)-2-fluoro-N-(3-isoquinolin-1-yl-4-methylphenyl)benzamide is Cc1ccc(NC(=O)c2ccc(N3CCCCS3(=O)=O)cc2F)cc1-c1nccc2ccccc12.
What is the InChIKey of 4-(1,1-dioxothiazinan-2-yl)-2-fluoro-N-(3-isoquinolin-1-yl-4-methylphenyl)benzamide?
The InChIKey is HGIWLYPNLKGOGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H24FN3O3S/c1-18-8-9-20(16-24(18)26-22-7-3-2-6-19(22)12-13-29-26)30-27(32)23-11-10-21(17-25(23)28)31-14-4-5-15-35(31,33)34/h2-3,6-13,16-17H,4-5,14-15H2,1H3,(H,30,32).
What are the key properties of 4-(1,1-dioxothiazinan-2-yl)-2-fluoro-N-(3-isoquinolin-1-yl-4-methylphenyl)benzamide?
4-(1,1-dioxothiazinan-2-yl)-2-fluoro-N-(3-isoquinolin-1-yl-4-methylphenyl)benzamide has a molecular weight of 489.57 g/mol, XLogP of 5.53, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,1-dioxothiazinan-2-yl)-2-fluoro-N-(3-isoquinolin-1-yl-4-methylphenyl)benzamide is sourced from PubChem (CID 90130105), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).