C26H22ClFN4O3S — CID 90130240
N-(4-chloro-3-quinazolin-2-ylphenyl)-4-(1,1-dioxothiazepan-2-yl)-2-fluorobenzamide (PubChem CID 90130240) has the molecular formula C26H22ClFN4O3S and a molecular weight of 525.01 g/mol. Its IUPAC name is N-(4-chloro-3-quinazolin-2-ylphenyl)-4-(1,1-dioxothiazepan-2-yl)-2-fluorobenzamide.
| Compound Name | N-(4-chloro-3-quinazolin-2-ylphenyl)-4-(1,1-dioxothiazepan-2-yl)-2-fluorobenzamide |
|---|---|
| PubChem CID | 90130240 |
| Molecular Formula | C26H22ClFN4O3S |
| Molecular Weight | 525.01 g/mol |
| Exact Mass | 524.11 |
| IUPAC Name | N-(4-chloro-3-quinazolin-2-ylphenyl)-4-(1,1-dioxothiazepan-2-yl)-2-fluorobenzamide |
| SMILES | O=C(Nc1ccc(Cl)c(-c2ncc3ccccc3n2)c1)c1ccc(N2CCCCCS2(=O)=O)cc1F |
| InChI | InChI=1S/C26H22ClFN4O3S/c27-22-11-8-18(14-21(22)25-29-16-17-6-2-3-7-24(17)31-25)30-26(33)20-10-9-19(15-23(20)28)32-12-4-1-5-13-36(32,34)35/h2-3,6-11,14-16H,1,4-5,12-13H2,(H,30,33) |
| InChIKey | JYBXSDVZQQFMPW-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.01 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |