C24H19ClN4O4S — CID 90130352
N-(4-chloro-3-quinazolin-2-ylphenyl)-4-(4,4-dioxo-1,4,3-oxathiazinan-3-yl)benzamide (PubChem CID 90130352) has the molecular formula C24H19ClN4O4S and a molecular weight of 494.96 g/mol. Its IUPAC name is N-(4-chloro-3-quinazolin-2-ylphenyl)-4-(4,4-dioxo-1,4,3-oxathiazinan-3-yl)benzamide.
| Compound Name | N-(4-chloro-3-quinazolin-2-ylphenyl)-4-(4,4-dioxo-1,4,3-oxathiazinan-3-yl)benzamide |
|---|---|
| PubChem CID | 90130352 |
| Molecular Formula | C24H19ClN4O4S |
| Molecular Weight | 494.96 g/mol |
| Exact Mass | 494.08 |
| IUPAC Name | N-(4-chloro-3-quinazolin-2-ylphenyl)-4-(4,4-dioxo-1,4,3-oxathiazinan-3-yl)benzamide |
| SMILES | O=C(Nc1ccc(Cl)c(-c2ncc3ccccc3n2)c1)c1ccc(N2COCCS2(=O)=O)cc1 |
| InChI | InChI=1S/C24H19ClN4O4S/c25-21-10-7-18(13-20(21)23-26-14-17-3-1-2-4-22(17)28-23)27-24(30)16-5-8-19(9-6-16)29-15-33-11-12-34(29,31)32/h1-10,13-14H,11-12,15H2,(H,27,30) |
| InChIKey | JFCVYXXWIVFJIJ-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 101.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.96 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |