C10H13F6NO3S2 — CID 90131007
O-(1,1,1,3,3,3-hexafluoropropan-2-yl) 1-methylsulfonylpiperidine-4-carbothioate (PubChem CID 90131007) has the molecular formula C10H13F6NO3S2 and a molecular weight of 373.34 g/mol. Its IUPAC name is O-(1,1,1,3,3,3-hexafluoropropan-2-yl) 1-methylsulfonylpiperidine-4-carbothioate.
| Compound Name | O-(1,1,1,3,3,3-hexafluoropropan-2-yl) 1-methylsulfonylpiperidine-4-carbothioate |
|---|---|
| PubChem CID | 90131007 |
| Molecular Formula | C10H13F6NO3S2 |
| Molecular Weight | 373.34 g/mol |
| Exact Mass | 373.02 |
| IUPAC Name | O-(1,1,1,3,3,3-hexafluoropropan-2-yl) 1-methylsulfonylpiperidine-4-carbothioate |
| SMILES | CS(=O)(=O)N1CCC(C(=S)OC(C(F)(F)F)C(F)(F)F)CC1 |
| InChI | InChI=1S/C10H13F6NO3S2/c1-22(18,19)17-4-2-6(3-5-17)7(21)20-8(9(11,12)13)10(14,15)16/h6,8H,2-5H2,1H3 |
| InChIKey | ADXRQFQYUXHWFF-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.34 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|