C33H55N3O5S2 — CID 90131087
[(3R)-4-[[3-[2-(2-aminoethyldisulfanyl)ethylamino]-3-oxopropyl]amino]-3-hydroxy-2,2-dimethyl-4-oxobutyl] (5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoate (PubChem CID 90131087) has the molecular formula C33H55N3O5S2 and a molecular weight of 637.95 g/mol. Its IUPAC name is [(3R)-4-[[3-[2-(2-aminoethyldisulfanyl)ethylamino]-3-oxopropyl]amino]-3-hydroxy-2,2-dimethyl-4-oxobutyl] (5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoate.
| Compound Name | [(3R)-4-[[3-[2-(2-aminoethyldisulfanyl)ethylamino]-3-oxopropyl]amino]-3-hydroxy-2,2-dimethyl-4-oxobutyl] (5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoate |
|---|---|
| PubChem CID | 90131087 |
| Molecular Formula | C33H55N3O5S2 |
| Molecular Weight | 637.95 g/mol |
| Exact Mass | 637.36 |
| IUPAC Name | [(3R)-4-[[3-[2-(2-aminoethyldisulfanyl)ethylamino]-3-oxopropyl]amino]-3-hydroxy-2,2-dimethyl-4-oxobutyl] (5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCCC(=O)OCC(C)(C)[C@@H](O)C(=O)NCCC(=O)NCCSSCCN |
| InChI | InChI=1S/C33H55N3O5S2/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-30(38)41-28-33(2,3)31(39)32(40)36-24-22-29(37)35-25-27-43-42-26-23-34/h5-6,8-9,11-12,14-15,17-18,31,39H,4,7,10,13,16,19-28,34H2,1-3H3,(H,35,37)(H,36,40)/b6-5-,9-8-,12-11-,15-14-,18-17-/t31-/m0/s1 |
| InChIKey | BOLFMMIBTOFQDB-PNEIDDTQSA-N |
| XLogP | 5.80 |
| TPSA | 130.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.95 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|