C27H31F3N6O3 — CID 90131701
tert-butyl 2'-oxo-1'-[[1-(4,4,4-trifluorobutyl)imidazo[4,5-b]pyridin-2-yl]methyl]spiro[piperidine-4,3'-pyrrolo[2,3-c]pyridine]-1-carboxylate (PubChem CID 90131701) has the molecular formula C27H31F3N6O3 and a molecular weight of 544.58 g/mol. Its IUPAC name is tert-butyl 2'-oxo-1'-[[1-(4,4,4-trifluorobutyl)imidazo[4,5-b]pyridin-2-yl]methyl]spiro[piperidine-4,3'-pyrrolo[2,3-c]pyridine]-1-carboxylate.
| Compound Name | tert-butyl 2'-oxo-1'-[[1-(4,4,4-trifluorobutyl)imidazo[4,5-b]pyridin-2-yl]methyl]spiro[piperidine-4,3'-pyrrolo[2,3-c]pyridine]-1-carboxylate |
|---|---|
| PubChem CID | 90131701 |
| Molecular Formula | C27H31F3N6O3 |
| Molecular Weight | 544.58 g/mol |
| Exact Mass | 544.24 |
| IUPAC Name | tert-butyl 2'-oxo-1'-[[1-(4,4,4-trifluorobutyl)imidazo[4,5-b]pyridin-2-yl]methyl]spiro[piperidine-4,3'-pyrrolo[2,3-c]pyridine]-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CC1)C(=O)N(Cc1nc3ncccc3n1CCCC(F)(F)F)c1cnccc12 |
| InChI | InChI=1S/C27H31F3N6O3/c1-25(2,3)39-24(38)34-14-9-26(10-15-34)18-7-12-31-16-20(18)36(23(26)37)17-21-33-22-19(6-4-11-32-22)35(21)13-5-8-27(28,29)30/h4,6-7,11-12,16H,5,8-10,13-15,17H2,1-3H3 |
| InChIKey | KEFIHBVHPYYBAK-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 93.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.58 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |