C20H20ClIN4O3S — CID 90132052
N-[2-chloro-5-[4-[(2R,6R)-2,6-dimethylmorpholin-4-yl]quinolin-6-yl]-3-pyridinyl]sulfamoyl iodide (PubChem CID 90132052) has the molecular formula C20H20ClIN4O3S and a molecular weight of 558.83 g/mol. Its IUPAC name is N-[2-chloro-5-[4-[(2R,6R)-2,6-dimethylmorpholin-4-yl]quinolin-6-yl]-3-pyridinyl]sulfamoyl iodide.
| Compound Name | N-[2-chloro-5-[4-[(2R,6R)-2,6-dimethylmorpholin-4-yl]quinolin-6-yl]-3-pyridinyl]sulfamoyl iodide |
|---|---|
| PubChem CID | 90132052 |
| Molecular Formula | C20H20ClIN4O3S |
| Molecular Weight | 558.83 g/mol |
| Exact Mass | 558.00 |
| IUPAC Name | N-[2-chloro-5-[4-[(2R,6R)-2,6-dimethylmorpholin-4-yl]quinolin-6-yl]-3-pyridinyl]sulfamoyl iodide |
| SMILES | C[C@@H]1CN(c2ccnc3ccc(-c4cnc(Cl)c(NS(=O)(=O)I)c4)cc23)C[C@@H](C)O1 |
| InChI | InChI=1S/C20H20ClIN4O3S/c1-12-10-26(11-13(2)29-12)19-5-6-23-17-4-3-14(7-16(17)19)15-8-18(20(21)24-9-15)25-30(22,27)28/h3-9,12-13,25H,10-11H2,1-2H3/t12-,13-/m1/s1 |
| InChIKey | NFZRIFPRIKVQST-CHWSQXEVSA-N |
| XLogP | 4.66 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.83 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|