About (Z)-2,2-difluoroundec-8-en-3-yn-5-ol
(Z)-2,2-difluoroundec-8-en-3-yn-5-ol (PubChem CID 90132556) has the molecular formula C11H16F2O
and a molecular weight of 202.24 g/mol. Its IUPAC name is (Z)-2,2-difluoroundec-8-en-3-yn-5-ol.
Molecular Properties
| Compound Name | (Z)-2,2-difluoroundec-8-en-3-yn-5-ol |
| PubChem CID | 90132556 |
| Molecular Formula | C11H16F2O |
| Molecular Weight | 202.24 g/mol |
| Exact Mass | 202.12 |
| IUPAC Name | (Z)-2,2-difluoroundec-8-en-3-yn-5-ol |
| SMILES | CC/C=C\CCC(O)C#CC(C)(F)F |
| InChI | InChI=1S/C11H16F2O/c1-3-4-5-6-7-10(14)8-9-11(2,12)13/h4-5,10,14H,3,6-7H2,1-2H3/b5-4- |
| InChIKey | NAGXJVRCXBXURQ-PLNGDYQASA-N |
| XLogP | 2.75 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.24 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (Z)-2,2-difluoroundec-8-en-3-yn-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-2,2-difluoroundec-8-en-3-yn-5-ol?
The IUPAC name of (Z)-2,2-difluoroundec-8-en-3-yn-5-ol (CID 90132556) is (Z)-2,2-difluoroundec-8-en-3-yn-5-ol.
What is the SMILES notation for (Z)-2,2-difluoroundec-8-en-3-yn-5-ol?
The canonical SMILES for (Z)-2,2-difluoroundec-8-en-3-yn-5-ol is CC/C=C\CCC(O)C#CC(C)(F)F.
What is the InChIKey of (Z)-2,2-difluoroundec-8-en-3-yn-5-ol?
The InChIKey is NAGXJVRCXBXURQ-PLNGDYQASA-N. The full InChI is InChI=1S/C11H16F2O/c1-3-4-5-6-7-10(14)8-9-11(2,12)13/h4-5,10,14H,3,6-7H2,1-2H3/b5-4-.
What are the key properties of (Z)-2,2-difluoroundec-8-en-3-yn-5-ol?
(Z)-2,2-difluoroundec-8-en-3-yn-5-ol has a molecular weight of 202.24 g/mol, XLogP of 2.75, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-2,2-difluoroundec-8-en-3-yn-5-ol is sourced from PubChem (CID 90132556), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).