C26H23BBrNO2 — CID 90132671
4-bromo-15-phenyl-9-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-15-azatetracyclo[10.2.1.05,14.08,13]pentadeca-1(14),2,4,6,8,10,12-heptaene (PubChem CID 90132671) has the molecular formula C26H23BBrNO2 and a molecular weight of 472.19 g/mol. Its IUPAC name is 4-bromo-15-phenyl-9-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-15-azatetracyclo[10.2.1.05,14.08,13]pentadeca-1(14),2,4,6,8,10,12-heptaene.
| Compound Name | 4-bromo-15-phenyl-9-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-15-azatetracyclo[10.2.1.05,14.08,13]pentadeca-1(14),2,4,6,8,10,12-heptaene |
|---|---|
| PubChem CID | 90132671 |
| Molecular Formula | C26H23BBrNO2 |
| Molecular Weight | 472.19 g/mol |
| Exact Mass | 471.10 |
| IUPAC Name | 4-bromo-15-phenyl-9-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-15-azatetracyclo[10.2.1.05,14.08,13]pentadeca-1(14),2,4,6,8,10,12-heptaene |
| SMILES | CC1(C)OB(c2ccc3c4c2ccc2c(Br)ccc(c24)n3-c2ccccc2)OC1(C)C |
| InChI | InChI=1S/C26H23BBrNO2/c1-25(2)26(3,4)31-27(30-25)19-12-14-21-23-17(19)10-11-18-20(28)13-15-22(24(18)23)29(21)16-8-6-5-7-9-16/h5-15H,1-4H3 |
| InChIKey | BHHBXEMYYWILJH-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 23.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.19 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|