C25H30Cl2F3N5O6S — CID 90133693
6-chloro-4-N-ethyl-2-N-propan-2-yl-1,3,5-triazine-2,4-diamine;2-[2-chloro-4-methylsulfonyl-3-(2,2,2-trifluoroethoxymethyl)benzoyl]cyclohexane-1,3-dione (PubChem CID 90133693) has the molecular formula C25H30Cl2F3N5O6S and a molecular weight of 656.51 g/mol. Its IUPAC name is 6-chloro-4-N-ethyl-2-N-propan-2-yl-1,3,5-triazine-2,4-diamine;2-[2-chloro-4-methylsulfonyl-3-(2,2,2-trifluoroethoxymethyl)benzoyl]cyclohexane-1,3-dione.
| Compound Name | 6-chloro-4-N-ethyl-2-N-propan-2-yl-1,3,5-triazine-2,4-diamine;2-[2-chloro-4-methylsulfonyl-3-(2,2,2-trifluoroethoxymethyl)benzoyl]cyclohexane-1,3-dione |
|---|---|
| PubChem CID | 90133693 |
| Molecular Formula | C25H30Cl2F3N5O6S |
| Molecular Weight | 656.51 g/mol |
| Exact Mass | 655.12 |
| IUPAC Name | 6-chloro-4-N-ethyl-2-N-propan-2-yl-1,3,5-triazine-2,4-diamine;2-[2-chloro-4-methylsulfonyl-3-(2,2,2-trifluoroethoxymethyl)benzoyl]cyclohexane-1,3-dione |
| SMILES | CCNc1nc(Cl)nc(NC(C)C)n1.CS(=O)(=O)c1ccc(C(=O)C2C(=O)CCCC2=O)c(Cl)c1COCC(F)(F)F |
| InChI | InChI=1S/C17H16ClF3O6S.C8H14ClN5/c1-28(25,26)13-6-5-9(15(18)10(13)7-27-8-17(19,20)21)16(24)14-11(22)3-2-4-12(14)23;1-4-10-7-12-6(9)13-8(14-7)11-5(2)3/h5-6,14H,2-4,7-8H2,1H3;5H,4H2,1-3H3,(H2,10,11,12,13,14) |
| InChIKey | HFLNKEVYMSVLHO-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 157.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.51 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|