About 2-bromo-2-(3,4-dihydroxyphenyl)acetaldehyde
2-bromo-2-(3,4-dihydroxyphenyl)acetaldehyde (PubChem CID 90134025) has the molecular formula C8H7BrO3
and a molecular weight of 231.04 g/mol. Its IUPAC name is 2-bromo-2-(3,4-dihydroxyphenyl)acetaldehyde.
Molecular Properties
| Compound Name | 2-bromo-2-(3,4-dihydroxyphenyl)acetaldehyde |
| PubChem CID | 90134025 |
| Molecular Formula | C8H7BrO3 |
| Molecular Weight | 231.04 g/mol |
| Exact Mass | 229.96 |
| IUPAC Name | 2-bromo-2-(3,4-dihydroxyphenyl)acetaldehyde |
| SMILES | O=CC(Br)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C8H7BrO3/c9-6(4-10)5-1-2-7(11)8(12)3-5/h1-4,6,11-12H |
| InChIKey | UGPPHNXSALYHHH-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.04 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-2-(3,4-dihydroxyphenyl)acetaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-2-(3,4-dihydroxyphenyl)acetaldehyde?
The IUPAC name of 2-bromo-2-(3,4-dihydroxyphenyl)acetaldehyde (CID 90134025) is 2-bromo-2-(3,4-dihydroxyphenyl)acetaldehyde.
What is the SMILES notation for 2-bromo-2-(3,4-dihydroxyphenyl)acetaldehyde?
The canonical SMILES for 2-bromo-2-(3,4-dihydroxyphenyl)acetaldehyde is O=CC(Br)c1ccc(O)c(O)c1.
What is the InChIKey of 2-bromo-2-(3,4-dihydroxyphenyl)acetaldehyde?
The InChIKey is UGPPHNXSALYHHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7BrO3/c9-6(4-10)5-1-2-7(11)8(12)3-5/h1-4,6,11-12H.
What are the key properties of 2-bromo-2-(3,4-dihydroxyphenyl)acetaldehyde?
2-bromo-2-(3,4-dihydroxyphenyl)acetaldehyde has a molecular weight of 231.04 g/mol, XLogP of 1.73, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-2-(3,4-dihydroxyphenyl)acetaldehyde is sourced from PubChem (CID 90134025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).