About 4-[[6-(2,4,6-trimethylanilino)-2-pyridinyl]amino]benzonitrile
4-[[6-(2,4,6-trimethylanilino)-2-pyridinyl]amino]benzonitrile (PubChem CID 90134115) has the molecular formula C21H20N4
and a molecular weight of 328.42 g/mol. Its IUPAC name is 4-[[6-(2,4,6-trimethylanilino)-2-pyridinyl]amino]benzonitrile.
Molecular Properties
| Compound Name | 4-[[6-(2,4,6-trimethylanilino)-2-pyridinyl]amino]benzonitrile |
| PubChem CID | 90134115 |
| Molecular Formula | C21H20N4 |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | 4-[[6-(2,4,6-trimethylanilino)-2-pyridinyl]amino]benzonitrile |
| SMILES | Cc1cc(C)c(Nc2cccc(Nc3ccc(C#N)cc3)n2)c(C)c1 |
| InChI | InChI=1S/C21H20N4/c1-14-11-15(2)21(16(3)12-14)25-20-6-4-5-19(24-20)23-18-9-7-17(13-22)8-10-18/h4-12H,1-3H3,(H2,23,24,25) |
| InChIKey | AUINTDBSRITDSX-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 60.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[[6-(2,4,6-trimethylanilino)-2-pyridinyl]amino]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[6-(2,4,6-trimethylanilino)-2-pyridinyl]amino]benzonitrile?
The IUPAC name of 4-[[6-(2,4,6-trimethylanilino)-2-pyridinyl]amino]benzonitrile (CID 90134115) is 4-[[6-(2,4,6-trimethylanilino)-2-pyridinyl]amino]benzonitrile.
What is the SMILES notation for 4-[[6-(2,4,6-trimethylanilino)-2-pyridinyl]amino]benzonitrile?
The canonical SMILES for 4-[[6-(2,4,6-trimethylanilino)-2-pyridinyl]amino]benzonitrile is Cc1cc(C)c(Nc2cccc(Nc3ccc(C#N)cc3)n2)c(C)c1.
What is the InChIKey of 4-[[6-(2,4,6-trimethylanilino)-2-pyridinyl]amino]benzonitrile?
The InChIKey is AUINTDBSRITDSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H20N4/c1-14-11-15(2)21(16(3)12-14)25-20-6-4-5-19(24-20)23-18-9-7-17(13-22)8-10-18/h4-12H,1-3H3,(H2,23,24,25).
What are the key properties of 4-[[6-(2,4,6-trimethylanilino)-2-pyridinyl]amino]benzonitrile?
4-[[6-(2,4,6-trimethylanilino)-2-pyridinyl]amino]benzonitrile has a molecular weight of 328.42 g/mol, XLogP of 5.37, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[6-(2,4,6-trimethylanilino)-2-pyridinyl]amino]benzonitrile is sourced from PubChem (CID 90134115), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).