About 6-(4-furo[3,2-c]pyridin-4-yloxy-2-methylphenyl)-5-methylpyrazin-2-amine
6-(4-furo[3,2-c]pyridin-4-yloxy-2-methylphenyl)-5-methylpyrazin-2-amine (PubChem CID 90134211) has the molecular formula C19H16N4O2
and a molecular weight of 332.36 g/mol. Its IUPAC name is 6-(4-furo[3,2-c]pyridin-4-yloxy-2-methylphenyl)-5-methylpyrazin-2-amine.
Molecular Properties
| Compound Name | 6-(4-furo[3,2-c]pyridin-4-yloxy-2-methylphenyl)-5-methylpyrazin-2-amine |
| PubChem CID | 90134211 |
| Molecular Formula | C19H16N4O2 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | 6-(4-furo[3,2-c]pyridin-4-yloxy-2-methylphenyl)-5-methylpyrazin-2-amine |
| SMILES | Cc1cc(Oc2nccc3occc23)ccc1-c1nc(N)cnc1C |
| InChI | InChI=1S/C19H16N4O2/c1-11-9-13(25-19-15-6-8-24-16(15)5-7-21-19)3-4-14(11)18-12(2)22-10-17(20)23-18/h3-10H,1-2H3,(H2,20,23) |
| InChIKey | RHEHBUAQMDRKJY-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 87.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 6-(4-furo[3,2-c]pyridin-4-yloxy-2-methylphenyl)-5-methylpyrazin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(4-furo[3,2-c]pyridin-4-yloxy-2-methylphenyl)-5-methylpyrazin-2-amine?
The IUPAC name of 6-(4-furo[3,2-c]pyridin-4-yloxy-2-methylphenyl)-5-methylpyrazin-2-amine (CID 90134211) is 6-(4-furo[3,2-c]pyridin-4-yloxy-2-methylphenyl)-5-methylpyrazin-2-amine.
What is the SMILES notation for 6-(4-furo[3,2-c]pyridin-4-yloxy-2-methylphenyl)-5-methylpyrazin-2-amine?
The canonical SMILES for 6-(4-furo[3,2-c]pyridin-4-yloxy-2-methylphenyl)-5-methylpyrazin-2-amine is Cc1cc(Oc2nccc3occc23)ccc1-c1nc(N)cnc1C.
What is the InChIKey of 6-(4-furo[3,2-c]pyridin-4-yloxy-2-methylphenyl)-5-methylpyrazin-2-amine?
The InChIKey is RHEHBUAQMDRKJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16N4O2/c1-11-9-13(25-19-15-6-8-24-16(15)5-7-21-19)3-4-14(11)18-12(2)22-10-17(20)23-18/h3-10H,1-2H3,(H2,20,23).
What are the key properties of 6-(4-furo[3,2-c]pyridin-4-yloxy-2-methylphenyl)-5-methylpyrazin-2-amine?
6-(4-furo[3,2-c]pyridin-4-yloxy-2-methylphenyl)-5-methylpyrazin-2-amine has a molecular weight of 332.36 g/mol, XLogP of 4.28, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(4-furo[3,2-c]pyridin-4-yloxy-2-methylphenyl)-5-methylpyrazin-2-amine is sourced from PubChem (CID 90134211), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).