C12H25N — CID 90134220
1,3-ditert-butyl-2,2,4-trideuterio-4-methylazetidine (PubChem CID 90134220) has the molecular formula C12H25N and a molecular weight of 186.36 g/mol. Its IUPAC name is 1,3-ditert-butyl-2,2,4-trideuterio-4-methylazetidine.
| Compound Name | 1,3-ditert-butyl-2,2,4-trideuterio-4-methylazetidine |
|---|---|
| PubChem CID | 90134220 |
| Molecular Formula | C12H25N |
| Molecular Weight | 186.36 g/mol |
| Exact Mass | 186.22 |
| IUPAC Name | 1,3-ditert-butyl-2,2,4-trideuterio-4-methylazetidine |
| SMILES | [2H]C1([2H])C(C(C)(C)C)C([2H])(C)N1C(C)(C)C |
| InChI | InChI=1S/C12H25N/c1-9-10(11(2,3)4)8-13(9)12(5,6)7/h9-10H,8H2,1-7H3/i8D2,9D |
| InChIKey | MAGKABFLUDDRNJ-YBGYDHGYSA-N |
| XLogP | 3.15 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.36 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |