About 3-bromo-6-(4-furo[3,2-c]pyridin-4-yloxy-2-methylphenyl)-5-methylpyrazin-2-amine
3-bromo-6-(4-furo[3,2-c]pyridin-4-yloxy-2-methylphenyl)-5-methylpyrazin-2-amine (PubChem CID 90134293) has the molecular formula C19H15BrN4O2
and a molecular weight of 411.26 g/mol. Its IUPAC name is 3-bromo-6-(4-furo[3,2-c]pyridin-4-yloxy-2-methylphenyl)-5-methylpyrazin-2-amine.
Molecular Properties
| Compound Name | 3-bromo-6-(4-furo[3,2-c]pyridin-4-yloxy-2-methylphenyl)-5-methylpyrazin-2-amine |
| PubChem CID | 90134293 |
| Molecular Formula | C19H15BrN4O2 |
| Molecular Weight | 411.26 g/mol |
| Exact Mass | 410.04 |
| IUPAC Name | 3-bromo-6-(4-furo[3,2-c]pyridin-4-yloxy-2-methylphenyl)-5-methylpyrazin-2-amine |
| SMILES | Cc1cc(Oc2nccc3occc23)ccc1-c1nc(N)c(Br)nc1C |
| InChI | InChI=1S/C19H15BrN4O2/c1-10-9-12(26-19-14-6-8-25-15(14)5-7-22-19)3-4-13(10)16-11(2)23-17(20)18(21)24-16/h3-9H,1-2H3,(H2,21,24) |
| InChIKey | FJLNHSVUMXZWRZ-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 87.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 411.26 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-bromo-6-(4-furo[3,2-c]pyridin-4-yloxy-2-methylphenyl)-5-methylpyrazin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-6-(4-furo[3,2-c]pyridin-4-yloxy-2-methylphenyl)-5-methylpyrazin-2-amine?
The IUPAC name of 3-bromo-6-(4-furo[3,2-c]pyridin-4-yloxy-2-methylphenyl)-5-methylpyrazin-2-amine (CID 90134293) is 3-bromo-6-(4-furo[3,2-c]pyridin-4-yloxy-2-methylphenyl)-5-methylpyrazin-2-amine.
What is the SMILES notation for 3-bromo-6-(4-furo[3,2-c]pyridin-4-yloxy-2-methylphenyl)-5-methylpyrazin-2-amine?
The canonical SMILES for 3-bromo-6-(4-furo[3,2-c]pyridin-4-yloxy-2-methylphenyl)-5-methylpyrazin-2-amine is Cc1cc(Oc2nccc3occc23)ccc1-c1nc(N)c(Br)nc1C.
What is the InChIKey of 3-bromo-6-(4-furo[3,2-c]pyridin-4-yloxy-2-methylphenyl)-5-methylpyrazin-2-amine?
The InChIKey is FJLNHSVUMXZWRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15BrN4O2/c1-10-9-12(26-19-14-6-8-25-15(14)5-7-22-19)3-4-13(10)16-11(2)23-17(20)18(21)24-16/h3-9H,1-2H3,(H2,21,24).
What are the key properties of 3-bromo-6-(4-furo[3,2-c]pyridin-4-yloxy-2-methylphenyl)-5-methylpyrazin-2-amine?
3-bromo-6-(4-furo[3,2-c]pyridin-4-yloxy-2-methylphenyl)-5-methylpyrazin-2-amine has a molecular weight of 411.26 g/mol, XLogP of 5.04, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-6-(4-furo[3,2-c]pyridin-4-yloxy-2-methylphenyl)-5-methylpyrazin-2-amine is sourced from PubChem (CID 90134293), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).