About (4R)-2-ethyl-1,2-oxazolidin-4-amine
(4R)-2-ethyl-1,2-oxazolidin-4-amine (PubChem CID 90134360) has the molecular formula C5H12N2O
and a molecular weight of 116.16 g/mol. Its IUPAC name is (4R)-2-ethyl-1,2-oxazolidin-4-amine.
Molecular Properties
| Compound Name | (4R)-2-ethyl-1,2-oxazolidin-4-amine |
| PubChem CID | 90134360 |
| Molecular Formula | C5H12N2O |
| Molecular Weight | 116.16 g/mol |
| Exact Mass | 116.09 |
| IUPAC Name | (4R)-2-ethyl-1,2-oxazolidin-4-amine |
| SMILES | CCN1C[C@@H](N)CO1 |
| InChI | InChI=1S/C5H12N2O/c1-2-7-3-5(6)4-8-7/h5H,2-4,6H2,1H3/t5-/m1/s1 |
| InChIKey | NGPWTWPZSOVDRT-RXMQYKEDSA-N |
| XLogP | -0.42 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 116.16 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4R)-2-ethyl-1,2-oxazolidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-2-ethyl-1,2-oxazolidin-4-amine?
The IUPAC name of (4R)-2-ethyl-1,2-oxazolidin-4-amine (CID 90134360) is (4R)-2-ethyl-1,2-oxazolidin-4-amine.
What is the SMILES notation for (4R)-2-ethyl-1,2-oxazolidin-4-amine?
The canonical SMILES for (4R)-2-ethyl-1,2-oxazolidin-4-amine is CCN1C[C@@H](N)CO1.
What is the InChIKey of (4R)-2-ethyl-1,2-oxazolidin-4-amine?
The InChIKey is NGPWTWPZSOVDRT-RXMQYKEDSA-N. The full InChI is InChI=1S/C5H12N2O/c1-2-7-3-5(6)4-8-7/h5H,2-4,6H2,1H3/t5-/m1/s1.
What are the key properties of (4R)-2-ethyl-1,2-oxazolidin-4-amine?
(4R)-2-ethyl-1,2-oxazolidin-4-amine has a molecular weight of 116.16 g/mol, XLogP of -0.42, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-2-ethyl-1,2-oxazolidin-4-amine is sourced from PubChem (CID 90134360), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).