About [(2S)-2-aminopropanoyl] undecanoate
[(2S)-2-aminopropanoyl] undecanoate (PubChem CID 90134834) has the molecular formula C14H27NO3
and a molecular weight of 257.37 g/mol. Its IUPAC name is [(2S)-2-aminopropanoyl] undecanoate.
Molecular Properties
| Compound Name | [(2S)-2-aminopropanoyl] undecanoate |
| PubChem CID | 90134834 |
| Molecular Formula | C14H27NO3 |
| Molecular Weight | 257.37 g/mol |
| Exact Mass | 257.20 |
| IUPAC Name | [(2S)-2-aminopropanoyl] undecanoate |
| SMILES | CCCCCCCCCCC(=O)OC(=O)[C@H](C)N |
| InChI | InChI=1S/C14H27NO3/c1-3-4-5-6-7-8-9-10-11-13(16)18-14(17)12(2)15/h12H,3-11,15H2,1-2H3/t12-/m0/s1 |
| InChIKey | VIWZMEBUSBSMMN-LBPRGKRZSA-N |
| XLogP | 2.93 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.37 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze [(2S)-2-aminopropanoyl] undecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S)-2-aminopropanoyl] undecanoate?
The IUPAC name of [(2S)-2-aminopropanoyl] undecanoate (CID 90134834) is [(2S)-2-aminopropanoyl] undecanoate.
What is the SMILES notation for [(2S)-2-aminopropanoyl] undecanoate?
The canonical SMILES for [(2S)-2-aminopropanoyl] undecanoate is CCCCCCCCCCC(=O)OC(=O)[C@H](C)N.
What is the InChIKey of [(2S)-2-aminopropanoyl] undecanoate?
The InChIKey is VIWZMEBUSBSMMN-LBPRGKRZSA-N. The full InChI is InChI=1S/C14H27NO3/c1-3-4-5-6-7-8-9-10-11-13(16)18-14(17)12(2)15/h12H,3-11,15H2,1-2H3/t12-/m0/s1.
What are the key properties of [(2S)-2-aminopropanoyl] undecanoate?
[(2S)-2-aminopropanoyl] undecanoate has a molecular weight of 257.37 g/mol, XLogP of 2.93, 10 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S)-2-aminopropanoyl] undecanoate is sourced from PubChem (CID 90134834), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).