C21H22FN7O3 — CID 90134908
6-[(5-fluoro-4-methyl-2-pyridinyl)amino]-4-[3-(hydrazinecarbonyl)-2-methoxyanilino]-N-methylpyridine-3-carboxamide (PubChem CID 90134908) has the molecular formula C21H22FN7O3 and a molecular weight of 439.45 g/mol. Its IUPAC name is 6-[(5-fluoro-4-methyl-2-pyridinyl)amino]-4-[3-(hydrazinecarbonyl)-2-methoxyanilino]-N-methylpyridine-3-carboxamide.
| Compound Name | 6-[(5-fluoro-4-methyl-2-pyridinyl)amino]-4-[3-(hydrazinecarbonyl)-2-methoxyanilino]-N-methylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 90134908 |
| Molecular Formula | C21H22FN7O3 |
| Molecular Weight | 439.45 g/mol |
| Exact Mass | 439.18 |
| IUPAC Name | 6-[(5-fluoro-4-methyl-2-pyridinyl)amino]-4-[3-(hydrazinecarbonyl)-2-methoxyanilino]-N-methylpyridine-3-carboxamide |
| SMILES | CNC(=O)c1cnc(Nc2cc(C)c(F)cn2)cc1Nc1cccc(C(=O)NN)c1OC |
| InChI | InChI=1S/C21H22FN7O3/c1-11-7-17(26-10-14(11)22)28-18-8-16(13(9-25-18)20(30)24-2)27-15-6-4-5-12(19(15)32-3)21(31)29-23/h4-10H,23H2,1-3H3,(H,24,30)(H,29,31)(H2,25,26,27,28) |
| InChIKey | ICJRIGVJFWZJDN-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 143.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.45 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|