C15H21N5O5S — CID 90135144
(3R)-1-[(4-amino-5H-pyrrolo[3,2-d]pyrimidin-7-yl)methyl]-2-(methylsulfanylmethyl)pyrrolidin-3-ol;oxalic acid (PubChem CID 90135144) has the molecular formula C15H21N5O5S and a molecular weight of 383.43 g/mol. Its IUPAC name is (3R)-1-[(4-amino-5H-pyrrolo[3,2-d]pyrimidin-7-yl)methyl]-2-(methylsulfanylmethyl)pyrrolidin-3-ol;oxalic acid.
| Compound Name | (3R)-1-[(4-amino-5H-pyrrolo[3,2-d]pyrimidin-7-yl)methyl]-2-(methylsulfanylmethyl)pyrrolidin-3-ol;oxalic acid |
|---|---|
| PubChem CID | 90135144 |
| Molecular Formula | C15H21N5O5S |
| Molecular Weight | 383.43 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | (3R)-1-[(4-amino-5H-pyrrolo[3,2-d]pyrimidin-7-yl)methyl]-2-(methylsulfanylmethyl)pyrrolidin-3-ol;oxalic acid |
| SMILES | CSCC1[C@H](O)CCN1Cc1c[nH]c2c(N)ncnc12.O=C(O)C(=O)O |
| InChI | InChI=1S/C13H19N5OS.C2H2O4/c1-20-6-9-10(19)2-3-18(9)5-8-4-15-12-11(8)16-7-17-13(12)14;3-1(4)2(5)6/h4,7,9-10,15,19H,2-3,5-6H2,1H3,(H2,14,16,17);(H,3,4)(H,5,6)/t9?,10-;/m1./s1 |
| InChIKey | RGKWBVIMCZZLLG-FJYJDOHQSA-N |
| XLogP | -0.01 |
| TPSA | 165.66 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.43 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|